C15H30N2 — CID 79067883
4-N,4-N,4-triethyl-3-N-propylhex-1-yne-3,4-diamine (PubChem CID 79067883) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 4-N,4-N,4-triethyl-3-N-propylhex-1-yne-3,4-diamine.
| Compound Name | 4-N,4-N,4-triethyl-3-N-propylhex-1-yne-3,4-diamine |
|---|---|
| PubChem CID | 79067883 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 4-N,4-N,4-triethyl-3-N-propylhex-1-yne-3,4-diamine |
| SMILES | C#CC(NCCC)C(CC)(CC)N(CC)CC |
| InChI | InChI=1S/C15H30N2/c1-7-13-16-14(8-2)15(9-3,10-4)17(11-5)12-6/h2,14,16H,7,9-13H2,1,3-6H3 |
| InChIKey | BCRVSJWSAJIPNW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|