About 3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine
3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine (PubChem CID 79068530) has the molecular formula C16H32N2
and a molecular weight of 252.45 g/mol. Its IUPAC name is 3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine.
Molecular Properties
| Compound Name | 3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine |
| PubChem CID | 79068530 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine |
| SMILES | CC#CCC(NCCC)C(C)(CC)N(CC)CC |
| InChI | InChI=1S/C16H32N2/c1-7-12-13-15(17-14-8-2)16(6,9-3)18(10-4)11-5/h15,17H,8-11,13-14H2,1-6H3 |
| InChIKey | DFWLNAJUCNFADK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine?
The IUPAC name of 3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine (CID 79068530) is 3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine.
What is the SMILES notation for 3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine?
The canonical SMILES for 3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine is CC#CCC(NCCC)C(C)(CC)N(CC)CC.
What is the InChIKey of 3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine?
The InChIKey is DFWLNAJUCNFADK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2/c1-7-12-13-15(17-14-8-2)16(6,9-3)18(10-4)11-5/h15,17H,8-11,13-14H2,1-6H3.
What are the key properties of 3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine?
3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine has a molecular weight of 252.45 g/mol, XLogP of 3.28, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N-diethyl-3-methyl-4-N-propyloct-6-yne-3,4-diamine is sourced from PubChem (CID 79068530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).