C14H32N2 — CID 79068984
3-N,3-N-diethyl-4-N,3,6-trimethylheptane-3,4-diamine (PubChem CID 79068984) has the molecular formula C14H32N2 and a molecular weight of 228.42 g/mol. Its IUPAC name is 3-N,3-N-diethyl-4-N,3,6-trimethylheptane-3,4-diamine.
| Compound Name | 3-N,3-N-diethyl-4-N,3,6-trimethylheptane-3,4-diamine |
|---|---|
| PubChem CID | 79068984 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | 3-N,3-N-diethyl-4-N,3,6-trimethylheptane-3,4-diamine |
| SMILES | CCN(CC)C(C)(CC)C(CC(C)C)NC |
| InChI | InChI=1S/C14H32N2/c1-8-14(6,16(9-2)10-3)13(15-7)11-12(4)5/h12-13,15H,8-11H2,1-7H3 |
| InChIKey | FOTDEJQCGJFUGA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |