About 3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine
3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine (PubChem CID 79069138) has the molecular formula C13H28N2
and a molecular weight of 212.38 g/mol. Its IUPAC name is 3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine.
Molecular Properties
| Compound Name | 3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine |
| PubChem CID | 79069138 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine |
| SMILES | C=CCCC(N)C(C)(CC)N(CC)CC |
| InChI | InChI=1S/C13H28N2/c1-6-10-11-12(14)13(5,7-2)15(8-3)9-4/h6,12H,1,7-11,14H2,2-5H3 |
| InChIKey | NCSODGQRAOHFLE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine?
The IUPAC name of 3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine (CID 79069138) is 3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine.
What is the SMILES notation for 3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine?
The canonical SMILES for 3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine is C=CCCC(N)C(C)(CC)N(CC)CC.
What is the InChIKey of 3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine?
The InChIKey is NCSODGQRAOHFLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2/c1-6-10-11-12(14)13(5,7-2)15(8-3)9-4/h6,12H,1,7-11,14H2,2-5H3.
What are the key properties of 3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine?
3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine has a molecular weight of 212.38 g/mol, XLogP of 2.79, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N-diethyl-3-methyloct-7-ene-3,4-diamine is sourced from PubChem (CID 79069138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).