About 1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine
1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine (PubChem CID 79070597) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine.
Molecular Properties
| Compound Name | 1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine |
| PubChem CID | 79070597 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine |
| SMILES | C=CCCCC(N)C1(N(C)C)CCCC1 |
| InChI | InChI=1S/C13H26N2/c1-4-5-6-9-12(14)13(15(2)3)10-7-8-11-13/h4,12H,1,5-11,14H2,2-3H3 |
| InChIKey | DFYOZHLTJWXEPF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine?
The IUPAC name of 1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine (CID 79070597) is 1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine.
What is the SMILES notation for 1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine?
The canonical SMILES for 1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine is C=CCCCC(N)C1(N(C)C)CCCC1.
What is the InChIKey of 1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine?
The InChIKey is DFYOZHLTJWXEPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-4-5-6-9-12(14)13(15(2)3)10-7-8-11-13/h4,12H,1,5-11,14H2,2-3H3.
What are the key properties of 1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine?
1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine has a molecular weight of 210.36 g/mol, XLogP of 2.54, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-aminohex-5-enyl)-N,N-dimethylcyclopentan-1-amine is sourced from PubChem (CID 79070597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).