C14H27N3O2 — CID 79071178
2-amino-3-methyl-N-[(4-methylmorpholin-2-yl)methyl]cyclohexane-1-carboxamide (PubChem CID 79071178) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-amino-3-methyl-N-[(4-methylmorpholin-2-yl)methyl]cyclohexane-1-carboxamide.
| Compound Name | 2-amino-3-methyl-N-[(4-methylmorpholin-2-yl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79071178 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 2-amino-3-methyl-N-[(4-methylmorpholin-2-yl)methyl]cyclohexane-1-carboxamide |
| SMILES | CC1CCCC(C(=O)NCC2CN(C)CCO2)C1N |
| InChI | InChI=1S/C14H27N3O2/c1-10-4-3-5-12(13(10)15)14(18)16-8-11-9-17(2)6-7-19-11/h10-13H,3-9,15H2,1-2H3,(H,16,18) |
| InChIKey | IONMDVVXGWKXHY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |