C13H20ClNO2 — CID 79071345
ethyl 2-amino-3,6-diethylbenzoate;hydrochloride (PubChem CID 79071345) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is ethyl 2-amino-3,6-diethylbenzoate;hydrochloride.
| Compound Name | ethyl 2-amino-3,6-diethylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 79071345 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | ethyl 2-amino-3,6-diethylbenzoate;hydrochloride |
| SMILES | CCOC(=O)c1c(CC)ccc(CC)c1N.Cl |
| InChI | InChI=1S/C13H19NO2.ClH/c1-4-9-7-8-10(5-2)12(14)11(9)13(15)16-6-3;/h7-8H,4-6,14H2,1-3H3;1H |
| InChIKey | MRQFKSXZEFRBAK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|