C16H28N4O — CID 79071615
N-[[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)imidazol-4-yl]methyl]-2-methylpropan-1-amine (PubChem CID 79071615) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is N-[[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)imidazol-4-yl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)imidazol-4-yl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 79071615 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | N-[[3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)imidazol-4-yl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cncn1CC1CN2CCCC2CO1 |
| InChI | InChI=1S/C16H28N4O/c1-13(2)6-17-7-15-8-18-12-20(15)10-16-9-19-5-3-4-14(19)11-21-16/h8,12-14,16-17H,3-7,9-11H2,1-2H3 |
| InChIKey | RBQLZJLCQVRGNR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |