C13H20N4O2 — CID 79071747
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-methoxypyrimidin-4-amine (PubChem CID 79071747) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-methoxypyrimidin-4-amine.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 79071747 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-6-methoxypyrimidin-4-amine |
| SMILES | COc1cc(NCC2CN3CCCC3CO2)ncn1 |
| InChI | InChI=1S/C13H20N4O2/c1-18-13-5-12(15-9-16-13)14-6-11-7-17-4-2-3-10(17)8-19-11/h5,9-11H,2-4,6-8H2,1H3,(H,14,15,16) |
| InChIKey | BSXHSDUSVWGFOW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |