About 5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine
5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine (PubChem CID 79072431) has the molecular formula C8H7BrClN5
and a molecular weight of 288.54 g/mol. Its IUPAC name is 5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine.
Molecular Properties
| Compound Name | 5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine |
| PubChem CID | 79072431 |
| Molecular Formula | C8H7BrClN5 |
| Molecular Weight | 288.54 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine |
| SMILES | Cc1nc(C)n(-c2nc(Cl)ncc2Br)n1 |
| InChI | InChI=1S/C8H7BrClN5/c1-4-12-5(2)15(14-4)7-6(9)3-11-8(10)13-7/h3H,1-2H3 |
| InChIKey | JEKPPHHIQRRZAR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine?
The IUPAC name of 5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine (CID 79072431) is 5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine.
What is the SMILES notation for 5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine?
The canonical SMILES for 5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine is Cc1nc(C)n(-c2nc(Cl)ncc2Br)n1.
What is the InChIKey of 5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine?
The InChIKey is JEKPPHHIQRRZAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrClN5/c1-4-12-5(2)15(14-4)7-6(9)3-11-8(10)13-7/h3H,1-2H3.
What are the key properties of 5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine?
5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine has a molecular weight of 288.54 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-chloro-4-(3,5-dimethyl-1,2,4-triazol-1-yl)pyrimidine is sourced from PubChem (CID 79072431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).