C11H6Cl3N5S — CID 79073212
3,5-dichloro-N-(2-chloro-5-methylpyrimidin-4-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine (PubChem CID 79073212) has the molecular formula C11H6Cl3N5S and a molecular weight of 346.63 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-chloro-5-methylpyrimidin-4-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine.
| Compound Name | 3,5-dichloro-N-(2-chloro-5-methylpyrimidin-4-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
|---|---|
| PubChem CID | 79073212 |
| Molecular Formula | C11H6Cl3N5S |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | 3,5-dichloro-N-(2-chloro-5-methylpyrimidin-4-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
| SMILES | Cc1cnc(Cl)nc1Nc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C11H6Cl3N5S/c1-4-3-15-11(14)17-10(4)16-7-5(12)2-6(13)8-9(7)19-20-18-8/h2-3H,1H3,(H,15,16,17) |
| InChIKey | KACWYPLXYJVVHW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |