About 2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine
2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine (PubChem CID 79073368) has the molecular formula C11H18ClN3
and a molecular weight of 227.74 g/mol. Its IUPAC name is 2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine |
| PubChem CID | 79073368 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine |
| SMILES | Cc1cnc(Cl)nc1N(C)CC(C)(C)C |
| InChI | InChI=1S/C11H18ClN3/c1-8-6-13-10(12)14-9(8)15(5)7-11(2,3)4/h6H,7H2,1-5H3 |
| InChIKey | QDHWAGYVLPBHAX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine?
The IUPAC name of 2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine (CID 79073368) is 2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine.
What is the SMILES notation for 2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine?
The canonical SMILES for 2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine is Cc1cnc(Cl)nc1N(C)CC(C)(C)C.
What is the InChIKey of 2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine?
The InChIKey is QDHWAGYVLPBHAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClN3/c1-8-6-13-10(12)14-9(8)15(5)7-11(2,3)4/h6H,7H2,1-5H3.
What are the key properties of 2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine?
2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine has a molecular weight of 227.74 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(2,2-dimethylpropyl)-N,5-dimethylpyrimidin-4-amine is sourced from PubChem (CID 79073368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).