About N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine
N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine (PubChem CID 79073683) has the molecular formula C9H14BrClN4
and a molecular weight of 293.60 g/mol. Its IUPAC name is N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine |
| PubChem CID | 79073683 |
| Molecular Formula | C9H14BrClN4 |
| Molecular Weight | 293.60 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine |
| SMILES | CCN(C)CCNc1nc(Cl)ncc1Br |
| InChI | InChI=1S/C9H14BrClN4/c1-3-15(2)5-4-12-8-7(10)6-13-9(11)14-8/h6H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | BQHURJGUBSHIHC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.60 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine?
The IUPAC name of N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine (CID 79073683) is N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine.
What is the SMILES notation for N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine?
The canonical SMILES for N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine is CCN(C)CCNc1nc(Cl)ncc1Br.
What is the InChIKey of N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine?
The InChIKey is BQHURJGUBSHIHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrClN4/c1-3-15(2)5-4-12-8-7(10)6-13-9(11)14-8/h6H,3-5H2,1-2H3,(H,12,13,14).
What are the key properties of N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine?
N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine has a molecular weight of 293.60 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromo-2-chloropyrimidin-4-yl)-N'-ethyl-N'-methylethane-1,2-diamine is sourced from PubChem (CID 79073683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).