About 1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine
1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine (PubChem CID 79074584) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine |
| PubChem CID | 79074584 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine |
| SMILES | C#CCC(N)C1(N(C)C)CCC(C)CC1 |
| InChI | InChI=1S/C13H24N2/c1-5-6-12(14)13(15(3)4)9-7-11(2)8-10-13/h1,11-12H,6-10,14H2,2-4H3 |
| InChIKey | RMUMIUNLNKKACS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine?
The IUPAC name of 1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine (CID 79074584) is 1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine.
What is the SMILES notation for 1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine?
The canonical SMILES for 1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine is C#CCC(N)C1(N(C)C)CCC(C)CC1.
What is the InChIKey of 1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine?
The InChIKey is RMUMIUNLNKKACS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2/c1-5-6-12(14)13(15(3)4)9-7-11(2)8-10-13/h1,11-12H,6-10,14H2,2-4H3.
What are the key properties of 1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine?
1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine has a molecular weight of 208.35 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-aminobut-3-ynyl)-N,N,4-trimethylcyclohexan-1-amine is sourced from PubChem (CID 79074584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).