About 2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine
2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine (PubChem CID 79076530) has the molecular formula C14H21ClN2O
and a molecular weight of 268.79 g/mol. Its IUPAC name is 2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine.
Molecular Properties
| Compound Name | 2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine |
| PubChem CID | 79076530 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine |
| SMILES | Cc1cnc(Cl)nc1OC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H21ClN2O/c1-9-5-11(7-14(3,4)6-9)18-12-10(2)8-16-13(15)17-12/h8-9,11H,5-7H2,1-4H3 |
| InChIKey | WMAWJNLAWVMVJW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine?
The IUPAC name of 2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine (CID 79076530) is 2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine.
What is the SMILES notation for 2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine?
The canonical SMILES for 2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine is Cc1cnc(Cl)nc1OC1CC(C)CC(C)(C)C1.
What is the InChIKey of 2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine?
The InChIKey is WMAWJNLAWVMVJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21ClN2O/c1-9-5-11(7-14(3,4)6-9)18-12-10(2)8-16-13(15)17-12/h8-9,11H,5-7H2,1-4H3.
What are the key properties of 2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine?
2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine has a molecular weight of 268.79 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-methyl-4-(3,3,5-trimethylcyclohexyl)oxypyrimidine is sourced from PubChem (CID 79076530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).