C10H3Cl3FN5S — CID 79076620
3,5-dichloro-N-(2-chloro-5-fluoropyrimidin-4-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine (PubChem CID 79076620) has the molecular formula C10H3Cl3FN5S and a molecular weight of 350.59 g/mol. Its IUPAC name is 3,5-dichloro-N-(2-chloro-5-fluoropyrimidin-4-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine.
| Compound Name | 3,5-dichloro-N-(2-chloro-5-fluoropyrimidin-4-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
|---|---|
| PubChem CID | 79076620 |
| Molecular Formula | C10H3Cl3FN5S |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | 3,5-dichloro-N-(2-chloro-5-fluoropyrimidin-4-yl)-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
| SMILES | Fc1cnc(Cl)nc1Nc1c(Cl)cc(Cl)c2c1N=S=N2 |
| InChI | InChI=1S/C10H3Cl3FN5S/c11-3-1-4(12)7-8(19-20-18-7)6(3)16-9-5(14)2-15-10(13)17-9/h1-2H,(H,15,16,17) |
| InChIKey | RTRKAHFNBZSXJP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |