C11H15N3O2 — CID 79077378
2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-1H-pyrimidin-6-one (PubChem CID 79077378) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-1H-pyrimidin-6-one.
| Compound Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 79077378 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(C2CN3CCCC3CO2)[nH]1 |
| InChI | InChI=1S/C11H15N3O2/c15-10-3-4-12-11(13-10)9-6-14-5-1-2-8(14)7-16-9/h3-4,8-9H,1-2,5-7H2,(H,12,13,15) |
| InChIKey | LGGAGEMCVTUFGT-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |