C16H22Cl2N2O — CID 79078593
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(2,5-dichlorophenyl)ethanamine (PubChem CID 79078593) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(2,5-dichlorophenyl)ethanamine.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(2,5-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 79078593 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-(2,5-dichlorophenyl)ethanamine |
| SMILES | CC(NCC1CN2CCCC2CO1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H22Cl2N2O/c1-11(15-7-12(17)4-5-16(15)18)19-8-14-9-20-6-2-3-13(20)10-21-14/h4-5,7,11,13-14,19H,2-3,6,8-10H2,1H3 |
| InChIKey | AWDBIBRJPVSRGS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |