C16H17FN2 — CID 79078877
N-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 79078877) has the molecular formula C16H17FN2 and a molecular weight of 256.32 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | N-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 79078877 |
| Molecular Formula | C16H17FN2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | Fc1cccc(CNC2CCCc3cccnc32)c1 |
| InChI | InChI=1S/C16H17FN2/c17-14-7-1-4-12(10-14)11-19-15-8-2-5-13-6-3-9-18-16(13)15/h1,3-4,6-7,9-10,15,19H,2,5,8,11H2 |
| InChIKey | MSYKYCWQXXZRBQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |