About 5-ethoxy-1,3-dihydrobenzimidazole-2-thione
5-ethoxy-1,3-dihydrobenzimidazole-2-thione (PubChem CID 790793) has the molecular formula C9H10N2OS
and a molecular weight of 194.26 g/mol. Its IUPAC name is 5-ethoxy-1,3-dihydrobenzimidazole-2-thione.
Molecular Properties
| Compound Name | 5-ethoxy-1,3-dihydrobenzimidazole-2-thione |
| PubChem CID | 790793 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | 5-ethoxy-1,3-dihydrobenzimidazole-2-thione |
| SMILES | CCOc1ccc2[nH]c(=S)[nH]c2c1 |
| InChI | InChI=1S/C9H10N2OS/c1-2-12-6-3-4-7-8(5-6)11-9(13)10-7/h3-5H,2H2,1H3,(H2,10,11,13) |
| InChIKey | WUSCBOFBIYZVCQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-ethoxy-1,3-dihydrobenzimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-1,3-dihydrobenzimidazole-2-thione?
The IUPAC name of 5-ethoxy-1,3-dihydrobenzimidazole-2-thione (CID 790793) is 5-ethoxy-1,3-dihydrobenzimidazole-2-thione.
What is the SMILES notation for 5-ethoxy-1,3-dihydrobenzimidazole-2-thione?
The canonical SMILES for 5-ethoxy-1,3-dihydrobenzimidazole-2-thione is CCOc1ccc2[nH]c(=S)[nH]c2c1.
What is the InChIKey of 5-ethoxy-1,3-dihydrobenzimidazole-2-thione?
The InChIKey is WUSCBOFBIYZVCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2OS/c1-2-12-6-3-4-7-8(5-6)11-9(13)10-7/h3-5H,2H2,1H3,(H2,10,11,13).
What are the key properties of 5-ethoxy-1,3-dihydrobenzimidazole-2-thione?
5-ethoxy-1,3-dihydrobenzimidazole-2-thione has a molecular weight of 194.26 g/mol, XLogP of 2.62, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-1,3-dihydrobenzimidazole-2-thione is sourced from PubChem (CID 790793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).