C6H8ClFN4O2S — CID 79080717
2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]ethanesulfonamide (PubChem CID 79080717) has the molecular formula C6H8ClFN4O2S and a molecular weight of 254.67 g/mol. Its IUPAC name is 2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]ethanesulfonamide.
| Compound Name | 2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]ethanesulfonamide |
|---|---|
| PubChem CID | 79080717 |
| Molecular Formula | C6H8ClFN4O2S |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNc1nc(Cl)ncc1F |
| InChI | InChI=1S/C6H8ClFN4O2S/c7-6-11-3-4(8)5(12-6)10-1-2-15(9,13)14/h3H,1-2H2,(H2,9,13,14)(H,10,11,12) |
| InChIKey | SIGZABHMYXDTBZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |