C10H13NO — CID 79081302
1-(pyridin-2-ylmethyl)cyclobutan-1-ol (PubChem CID 79081302) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-(pyridin-2-ylmethyl)cyclobutan-1-ol.
| Compound Name | 1-(pyridin-2-ylmethyl)cyclobutan-1-ol |
|---|---|
| PubChem CID | 79081302 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-(pyridin-2-ylmethyl)cyclobutan-1-ol |
| SMILES | OC1(Cc2ccccn2)CCC1 |
| InChI | InChI=1S/C10H13NO/c12-10(5-3-6-10)8-9-4-1-2-7-11-9/h1-2,4,7,12H,3,5-6,8H2 |
| InChIKey | KJUADSXEYSVWMA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |