C11H24N2 — CID 79081577
1-(1-aminoethyl)-N,N-dimethylcycloheptan-1-amine (PubChem CID 79081577) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-(1-aminoethyl)-N,N-dimethylcycloheptan-1-amine.
| Compound Name | 1-(1-aminoethyl)-N,N-dimethylcycloheptan-1-amine |
|---|---|
| PubChem CID | 79081577 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-(1-aminoethyl)-N,N-dimethylcycloheptan-1-amine |
| SMILES | CC(N)C1(N(C)C)CCCCCC1 |
| InChI | InChI=1S/C11H24N2/c1-10(12)11(13(2)3)8-6-4-5-7-9-11/h10H,4-9,12H2,1-3H3 |
| InChIKey | UNIUKBRUSMBZTD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |