About N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine
N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine (PubChem CID 79081851) has the molecular formula C10H16ClFN4
and a molecular weight of 246.72 g/mol. Its IUPAC name is N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine.
Molecular Properties
| Compound Name | N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine |
| PubChem CID | 79081851 |
| Molecular Formula | C10H16ClFN4 |
| Molecular Weight | 246.72 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine |
| SMILES | CN(C)CCCCNc1nc(Cl)ncc1F |
| InChI | InChI=1S/C10H16ClFN4/c1-16(2)6-4-3-5-13-9-8(12)7-14-10(11)15-9/h7H,3-6H2,1-2H3,(H,13,14,15) |
| InChIKey | XGJHWUZXCAARBO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.72 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine?
The IUPAC name of N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine (CID 79081851) is N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine.
What is the SMILES notation for N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine?
The canonical SMILES for N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine is CN(C)CCCCNc1nc(Cl)ncc1F.
What is the InChIKey of N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine?
The InChIKey is XGJHWUZXCAARBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClFN4/c1-16(2)6-4-3-5-13-9-8(12)7-14-10(11)15-9/h7H,3-6H2,1-2H3,(H,13,14,15).
What are the key properties of N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine?
N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine has a molecular weight of 246.72 g/mol, XLogP of 2.02, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-5-fluoropyrimidin-4-yl)-N',N'-dimethylbutane-1,4-diamine is sourced from PubChem (CID 79081851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).