C12H17NO4 — CID 79083924
5-[1-(3-hydroxypiperidin-1-yl)ethyl]furan-2-carboxylic acid (PubChem CID 79083924) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 5-[1-(3-hydroxypiperidin-1-yl)ethyl]furan-2-carboxylic acid.
| Compound Name | 5-[1-(3-hydroxypiperidin-1-yl)ethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 79083924 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 5-[1-(3-hydroxypiperidin-1-yl)ethyl]furan-2-carboxylic acid |
| SMILES | CC(c1ccc(C(=O)O)o1)N1CCCC(O)C1 |
| InChI | InChI=1S/C12H17NO4/c1-8(13-6-2-3-9(14)7-13)10-4-5-11(17-10)12(15)16/h4-5,8-9,14H,2-3,6-7H2,1H3,(H,15,16) |
| InChIKey | VAFMDXYAGLEFEQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |