About 5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine
5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine (PubChem CID 79084485) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine.
Molecular Properties
| Compound Name | 5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine |
| PubChem CID | 79084485 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine |
| SMILES | CCc1ccc(-c2nc(N)ns2)o1 |
| InChI | InChI=1S/C8H9N3OS/c1-2-5-3-4-6(12-5)7-10-8(9)11-13-7/h3-4H,2H2,1H3,(H2,9,11) |
| InChIKey | MOPFWOBQDLSNTR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine?
The IUPAC name of 5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine (CID 79084485) is 5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine.
What is the SMILES notation for 5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine?
The canonical SMILES for 5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine is CCc1ccc(-c2nc(N)ns2)o1.
What is the InChIKey of 5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine?
The InChIKey is MOPFWOBQDLSNTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-2-5-3-4-6(12-5)7-10-8(9)11-13-7/h3-4H,2H2,1H3,(H2,9,11).
What are the key properties of 5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine?
5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine has a molecular weight of 195.25 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-ethylfuran-2-yl)-1,2,4-thiadiazol-3-amine is sourced from PubChem (CID 79084485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).