C16H12ClN5O3S — CID 7908512
N-(4-chloro-2-nitrophenyl)-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 7908512) has the molecular formula C16H12ClN5O3S and a molecular weight of 389.82 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 7908512 |
| Molecular Formula | C16H12ClN5O3S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-2-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1n[nH]c(-c2ccccc2)n1)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12ClN5O3S/c17-11-6-7-12(13(8-11)22(24)25)18-14(23)9-26-16-19-15(20-21-16)10-4-2-1-3-5-10/h1-8H,9H2,(H,18,23)(H,19,20,21) |
| InChIKey | RNJIUKOXXFLHAS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|