C12H19N3O2 — CID 79086723
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-methylpyrazol-3-yl)methanol (PubChem CID 79086723) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-methylpyrazol-3-yl)methanol.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-methylpyrazol-3-yl)methanol |
|---|---|
| PubChem CID | 79086723 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-methylpyrazol-3-yl)methanol |
| SMILES | Cn1nccc1C(O)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C12H19N3O2/c1-14-10(4-5-13-14)12(16)11-7-15-6-2-3-9(15)8-17-11/h4-5,9,11-12,16H,2-3,6-8H2,1H3 |
| InChIKey | VLWLSENYFHQQEB-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |