C11H18F3NO2 — CID 79086724
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-4,4,4-trifluorobutan-1-ol (PubChem CID 79086724) has the molecular formula C11H18F3NO2 and a molecular weight of 253.26 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-4,4,4-trifluorobutan-1-ol.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 79086724 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-4,4,4-trifluorobutan-1-ol |
| SMILES | OC(CCC(F)(F)F)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C11H18F3NO2/c12-11(13,14)4-3-9(16)10-6-15-5-1-2-8(15)7-17-10/h8-10,16H,1-7H2 |
| InChIKey | ZNQQRRJOUHISCW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |