C14H17F2NO2 — CID 79086909
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2,3-difluorophenyl)methanol (PubChem CID 79086909) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2,3-difluorophenyl)methanol.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2,3-difluorophenyl)methanol |
|---|---|
| PubChem CID | 79086909 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2,3-difluorophenyl)methanol |
| SMILES | OC(c1cccc(F)c1F)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C14H17F2NO2/c15-11-5-1-4-10(13(11)16)14(18)12-7-17-6-2-3-9(17)8-19-12/h1,4-5,9,12,14,18H,2-3,6-8H2 |
| InChIKey | BJJGSBVZZGPZGD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |