C15H19F2NO2 — CID 79086911
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(2,4-difluorophenyl)ethanol (PubChem CID 79086911) has the molecular formula C15H19F2NO2 and a molecular weight of 283.32 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(2,4-difluorophenyl)ethanol.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(2,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 79086911 |
| Molecular Formula | C15H19F2NO2 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(2,4-difluorophenyl)ethanol |
| SMILES | OC(Cc1ccc(F)cc1F)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C15H19F2NO2/c16-11-4-3-10(13(17)7-11)6-14(19)15-8-18-5-1-2-12(18)9-20-15/h3-4,7,12,14-15,19H,1-2,5-6,8-9H2 |
| InChIKey | GNFPPFUEVKLGTP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |