C13H21N3O2 — CID 79087498
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-ethylpyrazol-3-yl)methanol (PubChem CID 79087498) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-ethylpyrazol-3-yl)methanol.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-ethylpyrazol-3-yl)methanol |
|---|---|
| PubChem CID | 79087498 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(2-ethylpyrazol-3-yl)methanol |
| SMILES | CCn1nccc1C(O)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C13H21N3O2/c1-2-16-11(5-6-14-16)13(17)12-8-15-7-3-4-10(15)9-18-12/h5-6,10,12-13,17H,2-4,7-9H2,1H3 |
| InChIKey | SCDXHUZQIUEXSC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |