C15H25N3O2 — CID 79087786
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(1-propan-2-ylpyrazol-3-yl)ethanol (PubChem CID 79087786) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(1-propan-2-ylpyrazol-3-yl)ethanol.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(1-propan-2-ylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 79087786 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(1-propan-2-ylpyrazol-3-yl)ethanol |
| SMILES | CC(C)n1ccc(CC(O)C2CN3CCCC3CO2)n1 |
| InChI | InChI=1S/C15H25N3O2/c1-11(2)18-7-5-12(16-18)8-14(19)15-9-17-6-3-4-13(17)10-20-15/h5,7,11,13-15,19H,3-4,6,8-10H2,1-2H3 |
| InChIKey | GXGGDNKTWDBDSS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |