About 1-N,1-N-diethylhex-5-ene-1,3-diamine
1-N,1-N-diethylhex-5-ene-1,3-diamine (PubChem CID 79087801) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 1-N,1-N-diethylhex-5-ene-1,3-diamine.
Molecular Properties
| Compound Name | 1-N,1-N-diethylhex-5-ene-1,3-diamine |
| PubChem CID | 79087801 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 1-N,1-N-diethylhex-5-ene-1,3-diamine |
| SMILES | C=CCC(N)CCN(CC)CC |
| InChI | InChI=1S/C10H22N2/c1-4-7-10(11)8-9-12(5-2)6-3/h4,10H,1,5-9,11H2,2-3H3 |
| InChIKey | BZLBCWFMCYDFMX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N,1-N-diethylhex-5-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N-diethylhex-5-ene-1,3-diamine?
The IUPAC name of 1-N,1-N-diethylhex-5-ene-1,3-diamine (CID 79087801) is 1-N,1-N-diethylhex-5-ene-1,3-diamine.
What is the SMILES notation for 1-N,1-N-diethylhex-5-ene-1,3-diamine?
The canonical SMILES for 1-N,1-N-diethylhex-5-ene-1,3-diamine is C=CCC(N)CCN(CC)CC.
What is the InChIKey of 1-N,1-N-diethylhex-5-ene-1,3-diamine?
The InChIKey is BZLBCWFMCYDFMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2/c1-4-7-10(11)8-9-12(5-2)6-3/h4,10H,1,5-9,11H2,2-3H3.
What are the key properties of 1-N,1-N-diethylhex-5-ene-1,3-diamine?
1-N,1-N-diethylhex-5-ene-1,3-diamine has a molecular weight of 170.30 g/mol, XLogP of 1.62, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N-diethylhex-5-ene-1,3-diamine is sourced from PubChem (CID 79087801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).