C14H22BrFN2 — CID 79087890
4-(2-bromo-5-fluorophenyl)-1-N,1-N-diethylbutane-1,3-diamine (PubChem CID 79087890) has the molecular formula C14H22BrFN2 and a molecular weight of 317.25 g/mol. Its IUPAC name is 4-(2-bromo-5-fluorophenyl)-1-N,1-N-diethylbutane-1,3-diamine.
| Compound Name | 4-(2-bromo-5-fluorophenyl)-1-N,1-N-diethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 79087890 |
| Molecular Formula | C14H22BrFN2 |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-(2-bromo-5-fluorophenyl)-1-N,1-N-diethylbutane-1,3-diamine |
| SMILES | CCN(CC)CCC(N)Cc1cc(F)ccc1Br |
| InChI | InChI=1S/C14H22BrFN2/c1-3-18(4-2)8-7-13(17)10-11-9-12(16)5-6-14(11)15/h5-6,9,13H,3-4,7-8,10,17H2,1-2H3 |
| InChIKey | VBZKRVHNETUYEQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |