C13H24N2O — CID 79088310
3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(cyclopentyl)methanamine (PubChem CID 79088310) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(cyclopentyl)methanamine.
| Compound Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(cyclopentyl)methanamine |
|---|---|
| PubChem CID | 79088310 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl(cyclopentyl)methanamine |
| SMILES | NC(C1CCCC1)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C13H24N2O/c14-13(10-4-1-2-5-10)12-8-15-7-3-6-11(15)9-16-12/h10-13H,1-9,14H2 |
| InChIKey | QBUGPCPXMKRGES-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |