About N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine
N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine (PubChem CID 79090210) has the molecular formula C11H16F3N3
and a molecular weight of 247.26 g/mol. Its IUPAC name is N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine.
Molecular Properties
| Compound Name | N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| PubChem CID | 79090210 |
| Molecular Formula | C11H16F3N3 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| SMILES | FC(F)(F)CN1CCC(Nn2cccc2)CC1 |
| InChI | InChI=1S/C11H16F3N3/c12-11(13,14)9-16-7-3-10(4-8-16)15-17-5-1-2-6-17/h1-2,5-6,10,15H,3-4,7-9H2 |
| InChIKey | RJXQEIIMVKTTGR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine?
The IUPAC name of N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine (CID 79090210) is N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine.
What is the SMILES notation for N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine?
The canonical SMILES for N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine is FC(F)(F)CN1CCC(Nn2cccc2)CC1.
What is the InChIKey of N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine?
The InChIKey is RJXQEIIMVKTTGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N3/c12-11(13,14)9-16-7-3-10(4-8-16)15-17-5-1-2-6-17/h1-2,5-6,10,15H,3-4,7-9H2.
What are the key properties of N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine?
N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine has a molecular weight of 247.26 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-pyrrol-1-yl-1-(2,2,2-trifluoroethyl)piperidin-4-amine is sourced from PubChem (CID 79090210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).