About N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine
N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine (PubChem CID 79090237) has the molecular formula C16H19FN2
and a molecular weight of 258.34 g/mol. Its IUPAC name is N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine.
Molecular Properties
| Compound Name | N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine |
| PubChem CID | 79090237 |
| Molecular Formula | C16H19FN2 |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine |
| SMILES | Cc1ccc(C)n1NC(c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C16H19FN2/c1-11-3-4-12(2)19(11)18-16(13-5-6-13)14-7-9-15(17)10-8-14/h3-4,7-10,13,16,18H,5-6H2,1-2H3 |
| InChIKey | FHGMLCLNAGQHQA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine?
The IUPAC name of N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine (CID 79090237) is N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine.
What is the SMILES notation for N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine?
The canonical SMILES for N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine is Cc1ccc(C)n1NC(c1ccc(F)cc1)C1CC1.
What is the InChIKey of N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine?
The InChIKey is FHGMLCLNAGQHQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19FN2/c1-11-3-4-12(2)19(11)18-16(13-5-6-13)14-7-9-15(17)10-8-14/h3-4,7-10,13,16,18H,5-6H2,1-2H3.
What are the key properties of N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine?
N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine has a molecular weight of 258.34 g/mol, XLogP of 3.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyclopropyl-(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine is sourced from PubChem (CID 79090237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).