C12H18N4 — CID 79090306
N-[(1-tert-butylpyrazol-4-yl)methyl]pyrrol-1-amine (PubChem CID 79090306) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is N-[(1-tert-butylpyrazol-4-yl)methyl]pyrrol-1-amine.
| Compound Name | N-[(1-tert-butylpyrazol-4-yl)methyl]pyrrol-1-amine |
|---|---|
| PubChem CID | 79090306 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | N-[(1-tert-butylpyrazol-4-yl)methyl]pyrrol-1-amine |
| SMILES | CC(C)(C)n1cc(CNn2cccc2)cn1 |
| InChI | InChI=1S/C12H18N4/c1-12(2,3)16-10-11(9-14-16)8-13-15-6-4-5-7-15/h4-7,9-10,13H,8H2,1-3H3 |
| InChIKey | PXMHELACDQSDBM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 34.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |