About N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine
N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine (PubChem CID 79090424) has the molecular formula C13H14F2N2
and a molecular weight of 236.26 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine.
Molecular Properties
| Compound Name | N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine |
| PubChem CID | 79090424 |
| Molecular Formula | C13H14F2N2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine |
| SMILES | Cc1ccc(C)n1NCc1ccc(F)cc1F |
| InChI | InChI=1S/C13H14F2N2/c1-9-3-4-10(2)17(9)16-8-11-5-6-12(14)7-13(11)15/h3-7,16H,8H2,1-2H3 |
| InChIKey | OBDVLLXNFIEEDB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine?
The IUPAC name of N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine (CID 79090424) is N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine.
What is the SMILES notation for N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine?
The canonical SMILES for N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine is Cc1ccc(C)n1NCc1ccc(F)cc1F.
What is the InChIKey of N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine?
The InChIKey is OBDVLLXNFIEEDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2/c1-9-3-4-10(2)17(9)16-8-11-5-6-12(14)7-13(11)15/h3-7,16H,8H2,1-2H3.
What are the key properties of N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine?
N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine has a molecular weight of 236.26 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-difluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine is sourced from PubChem (CID 79090424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).