About 4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide
4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide (PubChem CID 79090453) has the molecular formula C8H6BrCl2F2NO2S
and a molecular weight of 369.01 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide |
| PubChem CID | 79090453 |
| Molecular Formula | C8H6BrCl2F2NO2S |
| Molecular Weight | 369.01 g/mol |
| Exact Mass | 366.86 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(F)F)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C8H6BrCl2F2NO2S/c9-4-1-5(10)8(6(11)2-4)17(15,16)14-3-7(12)13/h1-2,7,14H,3H2 |
| InChIKey | DWBACAYVNRISCR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.01 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide?
The IUPAC name of 4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide (CID 79090453) is 4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide.
What is the SMILES notation for 4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide?
The canonical SMILES for 4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide is O=S(=O)(NCC(F)F)c1c(Cl)cc(Br)cc1Cl.
What is the InChIKey of 4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide?
The InChIKey is DWBACAYVNRISCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrCl2F2NO2S/c9-4-1-5(10)8(6(11)2-4)17(15,16)14-3-7(12)13/h1-2,7,14H,3H2.
What are the key properties of 4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide?
4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide has a molecular weight of 369.01 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,6-dichloro-N-(2,2-difluoroethyl)benzenesulfonamide is sourced from PubChem (CID 79090453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).