About methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate
methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate (PubChem CID 79090647) has the molecular formula C13H16N2O5
and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate |
| PubChem CID | 79090647 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(C)N2CC(=O)NC(=O)C2C)o1 |
| InChI | InChI=1S/C13H16N2O5/c1-7(9-4-5-10(20-9)13(18)19-3)15-6-11(16)14-12(17)8(15)2/h4-5,7-8H,6H2,1-3H3,(H,14,16,17) |
| InChIKey | MAZQYOZASSCZDZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate (CID 79090647) is methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate is COC(=O)c1ccc(C(C)N2CC(=O)NC(=O)C2C)o1.
What is the InChIKey of methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate?
The InChIKey is MAZQYOZASSCZDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O5/c1-7(9-4-5-10(20-9)13(18)19-3)15-6-11(16)14-12(17)8(15)2/h4-5,7-8H,6H2,1-3H3,(H,14,16,17).
What are the key properties of methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate?
methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate has a molecular weight of 280.28 g/mol, XLogP of 0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[1-(2-methyl-3,5-dioxopiperazin-1-yl)ethyl]furan-2-carboxylate is sourced from PubChem (CID 79090647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).