C18H20N2O — CID 79090793
2-[1-[(2,5-dimethylpyrrol-1-yl)amino]ethyl]naphthalen-1-ol (PubChem CID 79090793) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[1-[(2,5-dimethylpyrrol-1-yl)amino]ethyl]naphthalen-1-ol.
| Compound Name | 2-[1-[(2,5-dimethylpyrrol-1-yl)amino]ethyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 79090793 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-[1-[(2,5-dimethylpyrrol-1-yl)amino]ethyl]naphthalen-1-ol |
| SMILES | Cc1ccc(C)n1NC(C)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C18H20N2O/c1-12-8-9-13(2)20(12)19-14(3)16-11-10-15-6-4-5-7-17(15)18(16)21/h4-11,14,19,21H,1-3H3 |
| InChIKey | IKLIEXFJZXGAPZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|