3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid

C8H13N3O4S — CID 79091046

IUPAC3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid
SMILESCN(CCC(=O)O)S(=O)(=O)Nn1cccc1
InChIInChI=1S/C8H13N3O4S/c1-10(7-4-8(12)13)16(14,15)9-11-5-2-3-6-11/h2-3,5-6,9H,4,7H2,1H3,(H,12,13)
InChIKeyMHKVMHPBENRNLX-UHFFFAOYSA-N
MW247.28 g/mol
LogP-0.32
Rot. Bonds6

About 3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid

3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid (PubChem CID 79091046) has the molecular formula C8H13N3O4S and a molecular weight of 247.28 g/mol. Its IUPAC name is 3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid.

Molecular Properties

Compound Name3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid
PubChem CID79091046
Molecular FormulaC8H13N3O4S
Molecular Weight247.28 g/mol
Exact Mass247.06
IUPAC Name3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid
SMILESCN(CCC(=O)O)S(=O)(=O)Nn1cccc1
InChIInChI=1S/C8H13N3O4S/c1-10(7-4-8(12)13)16(14,15)9-11-5-2-3-6-11/h2-3,5-6,9H,4,7H2,1H3,(H,12,13)
InChIKeyMHKVMHPBENRNLX-UHFFFAOYSA-N
XLogP-0.32
TPSA91.64 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.28
LogP ≤ 5-0.32
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1H-Pyrrole-1-propanoic acid
CID 297621
2-Fluoro-2-methyl-3-pyrrol-1-ylpropanoic acid
CID 84654007
3,3,3-Trifluoro-2-[(pyrrol-1-ylamino)methyl]propanoic acid
CID 103255626
2,2-difluoro-3-[(1H-pyrrol-1-yl)amino]propanoic acid
CID 165463928
2-Methyl-3-pyrrol-1-ylpropanoic acid
CID 62676988
2-(Carboxymethylamino)acetic acid;pyrrol-1-amine
CID 66701684
1-Methylpyrrole;propanoic acid
CID 67687799
2-[(Pyrrol-1-ylamino)methyl]propanedioic acid
CID 69471076
3-(Pyrrol-1-ylamino)propanoic acid
CID 79100286
2,2-Dimethyl-3-pyrrol-1-ylpropanoic acid
CID 21663276
Methyl 4-(pyrrol-1-ylsulfamoyl)butanoate
CID 79089888
1-(Pyrrol-1-ylsulfamoyl)piperidine-4-carboxylic acid
CID 79090367

Frequently Asked Questions

What is the IUPAC name of 3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid?
The IUPAC name of 3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid (CID 79091046) is 3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid.
What is the SMILES notation for 3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid?
The canonical SMILES for 3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid is CN(CCC(=O)O)S(=O)(=O)Nn1cccc1.
What is the InChIKey of 3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid?
The InChIKey is MHKVMHPBENRNLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O4S/c1-10(7-4-8(12)13)16(14,15)9-11-5-2-3-6-11/h2-3,5-6,9H,4,7H2,1H3,(H,12,13).
What are the key properties of 3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid?
3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid has a molecular weight of 247.28 g/mol, XLogP of -0.32, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[methyl(pyrrol-1-ylsulfamoyl)amino]propanoic acid is sourced from PubChem (CID 79091046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).