C10H13ClN6O — CID 79091486
7-(5-amino-6-chloropyrimidin-4-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79091486) has the molecular formula C10H13ClN6O and a molecular weight of 268.71 g/mol. Its IUPAC name is 7-(5-amino-6-chloropyrimidin-4-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-(5-amino-6-chloropyrimidin-4-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79091486 |
| Molecular Formula | C10H13ClN6O |
| Molecular Weight | 268.71 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 7-(5-amino-6-chloropyrimidin-4-yl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | Nc1c(Cl)ncnc1N1CCN2C(=O)NCC2C1 |
| InChI | InChI=1S/C10H13ClN6O/c11-8-7(12)9(15-5-14-8)16-1-2-17-6(4-16)3-13-10(17)18/h5-6H,1-4,12H2,(H,13,18) |
| InChIKey | IPNPBKQSTUYHGO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.71 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |