C11H14BrN3OS — CID 79091597
7-[(4-bromothiophen-2-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79091597) has the molecular formula C11H14BrN3OS and a molecular weight of 316.22 g/mol. Its IUPAC name is 7-[(4-bromothiophen-2-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-[(4-bromothiophen-2-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79091597 |
| Molecular Formula | C11H14BrN3OS |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 7-[(4-bromothiophen-2-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | O=C1NCC2CN(Cc3cc(Br)cs3)CCN12 |
| InChI | InChI=1S/C11H14BrN3OS/c12-8-3-10(17-7-8)6-14-1-2-15-9(5-14)4-13-11(15)16/h3,7,9H,1-2,4-6H2,(H,13,16) |
| InChIKey | IHXVHOLGTQPQHV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |