C11H17N3O2 — CID 79091658
7-(2-oxocyclopentyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79091658) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 7-(2-oxocyclopentyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-(2-oxocyclopentyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79091658 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 7-(2-oxocyclopentyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | O=C1CCCC1N1CCN2C(=O)NCC2C1 |
| InChI | InChI=1S/C11H17N3O2/c15-10-3-1-2-9(10)13-4-5-14-8(7-13)6-12-11(14)16/h8-9H,1-7H2,(H,12,16) |
| InChIKey | IHXSMGJLYGRHAG-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |