C11H12N6O — CID 79091673
3-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)pyrazine-2-carbonitrile (PubChem CID 79091673) has the molecular formula C11H12N6O and a molecular weight of 244.26 g/mol. Its IUPAC name is 3-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)pyrazine-2-carbonitrile.
| Compound Name | 3-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 79091673 |
| Molecular Formula | C11H12N6O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1CCN2C(=O)NCC2C1 |
| InChI | InChI=1S/C11H12N6O/c12-5-9-10(14-2-1-13-9)16-3-4-17-8(7-16)6-15-11(17)18/h1-2,8H,3-4,6-7H2,(H,15,18) |
| InChIKey | OKJPZIDKYXULNG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |