C7H12ClN3O3S — CID 79095255
7-(chloromethylsulfonyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79095255) has the molecular formula C7H12ClN3O3S and a molecular weight of 253.71 g/mol. Its IUPAC name is 7-(chloromethylsulfonyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-(chloromethylsulfonyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79095255 |
| Molecular Formula | C7H12ClN3O3S |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 7-(chloromethylsulfonyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | O=C1NCC2CN(S(=O)(=O)CCl)CCN12 |
| InChI | InChI=1S/C7H12ClN3O3S/c8-5-15(13,14)10-1-2-11-6(4-10)3-9-7(11)12/h6H,1-5H2,(H,9,12) |
| InChIKey | MGNGCWAQHCMYGH-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|