C9H15N7OS — CID 79095395
7-[(5-hydrazinylthiadiazol-4-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79095395) has the molecular formula C9H15N7OS and a molecular weight of 269.33 g/mol. Its IUPAC name is 7-[(5-hydrazinylthiadiazol-4-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-[(5-hydrazinylthiadiazol-4-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79095395 |
| Molecular Formula | C9H15N7OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 7-[(5-hydrazinylthiadiazol-4-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | NNc1snnc1CN1CCN2C(=O)NCC2C1 |
| InChI | InChI=1S/C9H15N7OS/c10-12-8-7(13-14-18-8)5-15-1-2-16-6(4-15)3-11-9(16)17/h6,12H,1-5,10H2,(H,11,17) |
| InChIKey | QFHUNYIRUMDVOB-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|